C16H18N2O — CID 117006758
4-(4-ethoxyphenyl)-2,3-dihydro-1H-quinoxaline (PubChem CID 117006758) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-2,3-dihydro-1H-quinoxaline.
| Compound Name | 4-(4-ethoxyphenyl)-2,3-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 117006758 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 4-(4-ethoxyphenyl)-2,3-dihydro-1H-quinoxaline |
| SMILES | CCOc1ccc(N2CCNc3ccccc32)cc1 |
| InChI | InChI=1S/C16H18N2O/c1-2-19-14-9-7-13(8-10-14)18-12-11-17-15-5-3-4-6-16(15)18/h3-10,17H,2,11-12H2,1H3 |
| InChIKey | CVEQJYZKARBPJR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |