C13H16N2 — CID 117009815
1-(2,6-diethylphenyl)aziridine-2-carbonitrile (PubChem CID 117009815) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)aziridine-2-carbonitrile.
| Compound Name | 1-(2,6-diethylphenyl)aziridine-2-carbonitrile |
|---|---|
| PubChem CID | 117009815 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 1-(2,6-diethylphenyl)aziridine-2-carbonitrile |
| SMILES | CCc1cccc(CC)c1N1CC1C#N |
| InChI | InChI=1S/C13H16N2/c1-3-10-6-5-7-11(4-2)13(10)15-9-12(15)8-14/h5-7,12H,3-4,9H2,1-2H3 |
| InChIKey | QRYLGKWJTNBGPU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 26.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|