C17H21N3 — CID 117007926
1-(2,6-diethylphenyl)piperidine-4,4-dicarbonitrile (PubChem CID 117007926) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)piperidine-4,4-dicarbonitrile.
| Compound Name | 1-(2,6-diethylphenyl)piperidine-4,4-dicarbonitrile |
|---|---|
| PubChem CID | 117007926 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 1-(2,6-diethylphenyl)piperidine-4,4-dicarbonitrile |
| SMILES | CCc1cccc(CC)c1N1CCC(C#N)(C#N)CC1 |
| InChI | InChI=1S/C17H21N3/c1-3-14-6-5-7-15(4-2)16(14)20-10-8-17(12-18,13-19)9-11-20/h5-7H,3-4,8-11H2,1-2H3 |
| InChIKey | ISRBWEPQRAAAKR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |