3-(2,6-dimethylphenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid

C13H15NO4 — CID 117010267

IUPAC3-(2,6-dimethylphenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid
SMILESCc1cccc(C)c1N1CC(C(=O)O)COC1=O
InChIInChI=1S/C13H15NO4/c1-8-4-3-5-9(2)11(8)14-6-10(12(15)16)7-18-13(14)17/h3-5,10H,6-7H2,1-2H3,(H,15,16)
InChIKeySMSZMLURGXUIJS-UHFFFAOYSA-N
MW249.27 g/mol
LogP1.96
Rot. Bonds2

About 3-(2,6-dimethylphenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid

3-(2,6-dimethylphenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid (PubChem CID 117010267) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid.

Molecular Properties

Compound Name3-(2,6-dimethylphenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid
PubChem CID117010267
Molecular FormulaC13H15NO4
Molecular Weight249.27 g/mol
Exact Mass249.10
IUPAC Name3-(2,6-dimethylphenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid
SMILESCc1cccc(C)c1N1CC(C(=O)O)COC1=O
InChIInChI=1S/C13H15NO4/c1-8-4-3-5-9(2)11(8)14-6-10(12(15)16)7-18-13(14)17/h3-5,10H,6-7H2,1-2H3,(H,15,16)
InChIKeySMSZMLURGXUIJS-UHFFFAOYSA-N
XLogP1.96
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.27
LogP ≤ 51.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(2,6-dimethylphenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,6-dimethylphenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid?
The IUPAC name of 3-(2,6-dimethylphenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid (CID 117010267) is 3-(2,6-dimethylphenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid.
What is the SMILES notation for 3-(2,6-dimethylphenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid?
The canonical SMILES for 3-(2,6-dimethylphenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid is Cc1cccc(C)c1N1CC(C(=O)O)COC1=O.
What is the InChIKey of 3-(2,6-dimethylphenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid?
The InChIKey is SMSZMLURGXUIJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4/c1-8-4-3-5-9(2)11(8)14-6-10(12(15)16)7-18-13(14)17/h3-5,10H,6-7H2,1-2H3,(H,15,16).
What are the key properties of 3-(2,6-dimethylphenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid?
3-(2,6-dimethylphenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid has a molecular weight of 249.27 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dimethylphenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid is sourced from PubChem (CID 117010267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).