3-(4-cyanophenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid

C12H10N2O4 — CID 117010301

IUPAC3-(4-cyanophenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid
SMILESN#Cc1ccc(N2CC(C(=O)O)COC2=O)cc1
InChIInChI=1S/C12H10N2O4/c13-5-8-1-3-10(4-2-8)14-6-9(11(15)16)7-18-12(14)17/h1-4,9H,6-7H2,(H,15,16)
InChIKeyPLXLQGUENNRGFD-UHFFFAOYSA-N
MW246.22 g/mol
LogP1.22
Rot. Bonds2

About 3-(4-cyanophenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid

3-(4-cyanophenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid (PubChem CID 117010301) has the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. Its IUPAC name is 3-(4-cyanophenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid.

Molecular Properties

Compound Name3-(4-cyanophenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid
PubChem CID117010301
Molecular FormulaC12H10N2O4
Molecular Weight246.22 g/mol
Exact Mass246.06
IUPAC Name3-(4-cyanophenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid
SMILESN#Cc1ccc(N2CC(C(=O)O)COC2=O)cc1
InChIInChI=1S/C12H10N2O4/c13-5-8-1-3-10(4-2-8)14-6-9(11(15)16)7-18-12(14)17/h1-4,9H,6-7H2,(H,15,16)
InChIKeyPLXLQGUENNRGFD-UHFFFAOYSA-N
XLogP1.22
TPSA90.63 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.22
LogP ≤ 51.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(4-cyanophenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-cyanophenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid?
The IUPAC name of 3-(4-cyanophenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid (CID 117010301) is 3-(4-cyanophenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid.
What is the SMILES notation for 3-(4-cyanophenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid?
The canonical SMILES for 3-(4-cyanophenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid is N#Cc1ccc(N2CC(C(=O)O)COC2=O)cc1.
What is the InChIKey of 3-(4-cyanophenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid?
The InChIKey is PLXLQGUENNRGFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O4/c13-5-8-1-3-10(4-2-8)14-6-9(11(15)16)7-18-12(14)17/h1-4,9H,6-7H2,(H,15,16).
What are the key properties of 3-(4-cyanophenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid?
3-(4-cyanophenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid has a molecular weight of 246.22 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-cyanophenyl)-2-oxo-1,3-oxazinane-5-carboxylic acid is sourced from PubChem (CID 117010301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).