C6H8N2O2 — CID 117010522
3-methyl-2-oxo-1,3-oxazinane-5-carbonitrile (PubChem CID 117010522) has the molecular formula C6H8N2O2 and a molecular weight of 140.14 g/mol. Its IUPAC name is 3-methyl-2-oxo-1,3-oxazinane-5-carbonitrile.
| Compound Name | 3-methyl-2-oxo-1,3-oxazinane-5-carbonitrile |
|---|---|
| PubChem CID | 117010522 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 3-methyl-2-oxo-1,3-oxazinane-5-carbonitrile |
| SMILES | CN1CC(C#N)COC1=O |
| InChI | InChI=1S/C6H8N2O2/c1-8-3-5(2-7)4-10-6(8)9/h5H,3-4H2,1H3 |
| InChIKey | IWUVBUHUCBNEBX-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |