C14H20N2O2 — CID 117011771
4-amino-1-(2,5-dimethylphenyl)piperidine-4-carboxylic acid (PubChem CID 117011771) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 4-amino-1-(2,5-dimethylphenyl)piperidine-4-carboxylic acid.
| Compound Name | 4-amino-1-(2,5-dimethylphenyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 117011771 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 4-amino-1-(2,5-dimethylphenyl)piperidine-4-carboxylic acid |
| SMILES | Cc1ccc(C)c(N2CCC(N)(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C14H20N2O2/c1-10-3-4-11(2)12(9-10)16-7-5-14(15,6-8-16)13(17)18/h3-4,9H,5-8,15H2,1-2H3,(H,17,18) |
| InChIKey | OGULSPHNBRXYSD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |