C19H23N3O2 — CID 53214082
3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid (PubChem CID 53214082) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid.
| Compound Name | 3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 53214082 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid |
| SMILES | Cc1ccc(C)c(N2CCN(c3ccc(C(=O)O)cc3N)CC2)c1 |
| InChI | InChI=1S/C19H23N3O2/c1-13-3-4-14(2)18(11-13)22-9-7-21(8-10-22)17-6-5-15(19(23)24)12-16(17)20/h3-6,11-12H,7-10,20H2,1-2H3,(H,23,24) |
| InChIKey | KSOOSMQTCZJPHS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|