3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid

C19H23N3O2 — CID 53214082

IUPAC3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid
SMILESCc1ccc(C)c(N2CCN(c3ccc(C(=O)O)cc3N)CC2)c1
InChIInChI=1S/C19H23N3O2/c1-13-3-4-14(2)18(11-13)22-9-7-21(8-10-22)17-6-5-15(19(23)24)12-16(17)20/h3-6,11-12H,7-10,20H2,1-2H3,(H,23,24)
InChIKeyKSOOSMQTCZJPHS-UHFFFAOYSA-N
MW325.41 g/mol
LogP2.91
Rot. Bonds3

About 3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid

3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid (PubChem CID 53214082) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid.

Molecular Properties

Compound Name3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid
PubChem CID53214082
Molecular FormulaC19H23N3O2
Molecular Weight325.41 g/mol
Exact Mass325.18
IUPAC Name3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid
SMILESCc1ccc(C)c(N2CCN(c3ccc(C(=O)O)cc3N)CC2)c1
InChIInChI=1S/C19H23N3O2/c1-13-3-4-14(2)18(11-13)22-9-7-21(8-10-22)17-6-5-15(19(23)24)12-16(17)20/h3-6,11-12H,7-10,20H2,1-2H3,(H,23,24)
InChIKeyKSOOSMQTCZJPHS-UHFFFAOYSA-N
XLogP2.91
TPSA69.80 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.41
LogP ≤ 52.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid?
The IUPAC name of 3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid (CID 53214082) is 3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid.
What is the SMILES notation for 3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid?
The canonical SMILES for 3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid is Cc1ccc(C)c(N2CCN(c3ccc(C(=O)O)cc3N)CC2)c1.
What is the InChIKey of 3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid?
The InChIKey is KSOOSMQTCZJPHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O2/c1-13-3-4-14(2)18(11-13)22-9-7-21(8-10-22)17-6-5-15(19(23)24)12-16(17)20/h3-6,11-12H,7-10,20H2,1-2H3,(H,23,24).
What are the key properties of 3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid?
3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid has a molecular weight of 325.41 g/mol, XLogP of 2.91, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-[4-(2,5-dimethylphenyl)piperazin-1-yl]benzoic acid is sourced from PubChem (CID 53214082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).