C12H10F3NO2 — CID 117013796
1-[2-(trifluoromethyl)phenyl]piperidine-2,3-dione (PubChem CID 117013796) has the molecular formula C12H10F3NO2 and a molecular weight of 257.21 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)phenyl]piperidine-2,3-dione.
| Compound Name | 1-[2-(trifluoromethyl)phenyl]piperidine-2,3-dione |
|---|---|
| PubChem CID | 117013796 |
| Molecular Formula | C12H10F3NO2 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 1-[2-(trifluoromethyl)phenyl]piperidine-2,3-dione |
| SMILES | O=C1CCCN(c2ccccc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C12H10F3NO2/c13-12(14,15)8-4-1-2-5-9(8)16-7-3-6-10(17)11(16)18/h1-2,4-5H,3,6-7H2 |
| InChIKey | DMVZRXYUGAHTNL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|