C10H18O6 — CID 11701424
(4aR,6S,7R,8S,8aS)-6,7,8-trimethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 11701424) has the molecular formula C10H18O6 and a molecular weight of 234.25 g/mol. Its IUPAC name is (4aR,6S,7R,8S,8aS)-6,7,8-trimethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6S,7R,8S,8aS)-6,7,8-trimethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 11701424 |
| Molecular Formula | C10H18O6 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | (4aR,6S,7R,8S,8aS)-6,7,8-trimethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CO[C@H]1O[C@@H]2COCO[C@@H]2[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C10H18O6/c1-11-8-7-6(4-14-5-15-7)16-10(13-3)9(8)12-2/h6-10H,4-5H2,1-3H3/t6-,7+,8+,9-,10+/m1/s1 |
| InChIKey | XIPICTVNDPVOKD-KBDSZGMXSA-N |
| XLogP | -0.24 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |