C17H28N2 — CID 117014652
4,4-dimethyl-1-(2-propan-2-ylphenyl)-1,5-diazocane (PubChem CID 117014652) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 4,4-dimethyl-1-(2-propan-2-ylphenyl)-1,5-diazocane.
| Compound Name | 4,4-dimethyl-1-(2-propan-2-ylphenyl)-1,5-diazocane |
|---|---|
| PubChem CID | 117014652 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 4,4-dimethyl-1-(2-propan-2-ylphenyl)-1,5-diazocane |
| SMILES | CC(C)c1ccccc1N1CCCNC(C)(C)CC1 |
| InChI | InChI=1S/C17H28N2/c1-14(2)15-8-5-6-9-16(15)19-12-7-11-18-17(3,4)10-13-19/h5-6,8-9,14,18H,7,10-13H2,1-4H3 |
| InChIKey | CZIHBFDPUDYHQZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |