C16H26N2 — CID 117023755
5,5-dimethyl-1-(2-propan-2-ylphenyl)-1,4-diazepane (PubChem CID 117023755) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 5,5-dimethyl-1-(2-propan-2-ylphenyl)-1,4-diazepane.
| Compound Name | 5,5-dimethyl-1-(2-propan-2-ylphenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 117023755 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 5,5-dimethyl-1-(2-propan-2-ylphenyl)-1,4-diazepane |
| SMILES | CC(C)c1ccccc1N1CCNC(C)(C)CC1 |
| InChI | InChI=1S/C16H26N2/c1-13(2)14-7-5-6-8-15(14)18-11-9-16(3,4)17-10-12-18/h5-8,13,17H,9-12H2,1-4H3 |
| InChIKey | XCQVLOGDFRHOPO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |