C12H24N2 — CID 117014693
1-cyclopentyl-2-methyl-1,5-diazocane (PubChem CID 117014693) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 1-cyclopentyl-2-methyl-1,5-diazocane.
| Compound Name | 1-cyclopentyl-2-methyl-1,5-diazocane |
|---|---|
| PubChem CID | 117014693 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 1-cyclopentyl-2-methyl-1,5-diazocane |
| SMILES | CC1CCNCCCN1C1CCCC1 |
| InChI | InChI=1S/C12H24N2/c1-11-7-9-13-8-4-10-14(11)12-5-2-3-6-12/h11-13H,2-10H2,1H3 |
| InChIKey | HLTBNPGWNIFQEP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |