C13H26N2 — CID 63903287
4-(2,3-dimethylpiperidin-1-yl)azepane (PubChem CID 63903287) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 4-(2,3-dimethylpiperidin-1-yl)azepane.
| Compound Name | 4-(2,3-dimethylpiperidin-1-yl)azepane |
|---|---|
| PubChem CID | 63903287 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 4-(2,3-dimethylpiperidin-1-yl)azepane |
| SMILES | CC1CCCN(C2CCCNCC2)C1C |
| InChI | InChI=1S/C13H26N2/c1-11-5-4-10-15(12(11)2)13-6-3-8-14-9-7-13/h11-14H,3-10H2,1-2H3 |
| InChIKey | KWBMJPLBELBWKC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |