C12H10Cl2O3 — CID 11701778
methyl 2,5-bis(chloromethyl)-1-benzofuran-7-carboxylate (PubChem CID 11701778) has the molecular formula C12H10Cl2O3 and a molecular weight of 273.12 g/mol. Its IUPAC name is methyl 2,5-bis(chloromethyl)-1-benzofuran-7-carboxylate.
| Compound Name | methyl 2,5-bis(chloromethyl)-1-benzofuran-7-carboxylate |
|---|---|
| PubChem CID | 11701778 |
| Molecular Formula | C12H10Cl2O3 |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | methyl 2,5-bis(chloromethyl)-1-benzofuran-7-carboxylate |
| SMILES | COC(=O)c1cc(CCl)cc2cc(CCl)oc12 |
| InChI | InChI=1S/C12H10Cl2O3/c1-16-12(15)10-3-7(5-13)2-8-4-9(6-14)17-11(8)10/h2-4H,5-6H2,1H3 |
| InChIKey | PXFFFTCZWBDDQI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|