C12H17FN2 — CID 117018125
1-(2-fluorophenyl)-5,5-dimethylpyrrolidin-3-amine (PubChem CID 117018125) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-5,5-dimethylpyrrolidin-3-amine.
| Compound Name | 1-(2-fluorophenyl)-5,5-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 117018125 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 1-(2-fluorophenyl)-5,5-dimethylpyrrolidin-3-amine |
| SMILES | CC1(C)CC(N)CN1c1ccccc1F |
| InChI | InChI=1S/C12H17FN2/c1-12(2)7-9(14)8-15(12)11-6-4-3-5-10(11)13/h3-6,9H,7-8,14H2,1-2H3 |
| InChIKey | CPEZESNASZUHFF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |