C13H15BrN2 — CID 117018351
1-(3-bromophenyl)-5,5-dimethylpyrrolidine-3-carbonitrile (PubChem CID 117018351) has the molecular formula C13H15BrN2 and a molecular weight of 279.18 g/mol. Its IUPAC name is 1-(3-bromophenyl)-5,5-dimethylpyrrolidine-3-carbonitrile.
| Compound Name | 1-(3-bromophenyl)-5,5-dimethylpyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 117018351 |
| Molecular Formula | C13H15BrN2 |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 1-(3-bromophenyl)-5,5-dimethylpyrrolidine-3-carbonitrile |
| SMILES | CC1(C)CC(C#N)CN1c1cccc(Br)c1 |
| InChI | InChI=1S/C13H15BrN2/c1-13(2)7-10(8-15)9-16(13)12-5-3-4-11(14)6-12/h3-6,10H,7,9H2,1-2H3 |
| InChIKey | ABWMYGOUXRZKHI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |