C15H24BrN3 — CID 84607204
2-[4-(3-bromophenyl)-1,5,5-trimethylpiperazin-2-yl]ethanamine (PubChem CID 84607204) has the molecular formula C15H24BrN3 and a molecular weight of 326.28 g/mol. Its IUPAC name is 2-[4-(3-bromophenyl)-1,5,5-trimethylpiperazin-2-yl]ethanamine.
| Compound Name | 2-[4-(3-bromophenyl)-1,5,5-trimethylpiperazin-2-yl]ethanamine |
|---|---|
| PubChem CID | 84607204 |
| Molecular Formula | C15H24BrN3 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-[4-(3-bromophenyl)-1,5,5-trimethylpiperazin-2-yl]ethanamine |
| SMILES | CN1CC(C)(C)N(c2cccc(Br)c2)CC1CCN |
| InChI | InChI=1S/C15H24BrN3/c1-15(2)11-18(3)14(7-8-17)10-19(15)13-6-4-5-12(16)9-13/h4-6,9,14H,7-8,10-11,17H2,1-3H3 |
| InChIKey | IOVHQCIAURCFMH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |