C13H19BrN2 — CID 117018785
[1-(4-bromophenyl)-5,5-dimethylpyrrolidin-3-yl]methanamine (PubChem CID 117018785) has the molecular formula C13H19BrN2 and a molecular weight of 283.21 g/mol. Its IUPAC name is [1-(4-bromophenyl)-5,5-dimethylpyrrolidin-3-yl]methanamine.
| Compound Name | [1-(4-bromophenyl)-5,5-dimethylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 117018785 |
| Molecular Formula | C13H19BrN2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | [1-(4-bromophenyl)-5,5-dimethylpyrrolidin-3-yl]methanamine |
| SMILES | CC1(C)CC(CN)CN1c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H19BrN2/c1-13(2)7-10(8-15)9-16(13)12-5-3-11(14)4-6-12/h3-6,10H,7-9,15H2,1-2H3 |
| InChIKey | AWEJXJDGIBYJTK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |