C16H22N2O — CID 117021196
1-(2-ethoxyphenyl)-6,6-dimethylpiperidine-3-carbonitrile (PubChem CID 117021196) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-6,6-dimethylpiperidine-3-carbonitrile.
| Compound Name | 1-(2-ethoxyphenyl)-6,6-dimethylpiperidine-3-carbonitrile |
|---|---|
| PubChem CID | 117021196 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 1-(2-ethoxyphenyl)-6,6-dimethylpiperidine-3-carbonitrile |
| SMILES | CCOc1ccccc1N1CC(C#N)CCC1(C)C |
| InChI | InChI=1S/C16H22N2O/c1-4-19-15-8-6-5-7-14(15)18-12-13(11-17)9-10-16(18,2)3/h5-8,13H,4,9-10,12H2,1-3H3 |
| InChIKey | NJXZHAUPGHBJGK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |