C13H13BrN2O — CID 117022358
1-(3-bromo-4-methylphenyl)-2-methyl-5-oxopyrrolidine-3-carbonitrile (PubChem CID 117022358) has the molecular formula C13H13BrN2O and a molecular weight of 293.16 g/mol. Its IUPAC name is 1-(3-bromo-4-methylphenyl)-2-methyl-5-oxopyrrolidine-3-carbonitrile.
| Compound Name | 1-(3-bromo-4-methylphenyl)-2-methyl-5-oxopyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 117022358 |
| Molecular Formula | C13H13BrN2O |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 1-(3-bromo-4-methylphenyl)-2-methyl-5-oxopyrrolidine-3-carbonitrile |
| SMILES | Cc1ccc(N2C(=O)CC(C#N)C2C)cc1Br |
| InChI | InChI=1S/C13H13BrN2O/c1-8-3-4-11(6-12(8)14)16-9(2)10(7-15)5-13(16)17/h3-4,6,9-10H,5H2,1-2H3 |
| InChIKey | PHWLXEJZAHHVQT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |