C12H12BrNO3S — CID 84608760
4-(3-bromo-4-methylphenyl)-5-oxothiomorpholine-3-carboxylic acid (PubChem CID 84608760) has the molecular formula C12H12BrNO3S and a molecular weight of 330.20 g/mol. Its IUPAC name is 4-(3-bromo-4-methylphenyl)-5-oxothiomorpholine-3-carboxylic acid.
| Compound Name | 4-(3-bromo-4-methylphenyl)-5-oxothiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 84608760 |
| Molecular Formula | C12H12BrNO3S |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | 4-(3-bromo-4-methylphenyl)-5-oxothiomorpholine-3-carboxylic acid |
| SMILES | Cc1ccc(N2C(=O)CSCC2C(=O)O)cc1Br |
| InChI | InChI=1S/C12H12BrNO3S/c1-7-2-3-8(4-9(7)13)14-10(12(16)17)5-18-6-11(14)15/h2-4,10H,5-6H2,1H3,(H,16,17) |
| InChIKey | VLUOIFXATSWVIA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |