C12H15N3 — CID 117022412
2-methyl-1-(pyridin-2-ylmethyl)pyrrolidine-3-carbonitrile (PubChem CID 117022412) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-methyl-1-(pyridin-2-ylmethyl)pyrrolidine-3-carbonitrile.
| Compound Name | 2-methyl-1-(pyridin-2-ylmethyl)pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 117022412 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2-methyl-1-(pyridin-2-ylmethyl)pyrrolidine-3-carbonitrile |
| SMILES | CC1C(C#N)CCN1Cc1ccccn1 |
| InChI | InChI=1S/C12H15N3/c1-10-11(8-13)5-7-15(10)9-12-4-2-3-6-14-12/h2-4,6,10-11H,5,7,9H2,1H3 |
| InChIKey | SMRRUIMCVUHHDQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |