C17H20N4O2 — CID 11702358
ethyl 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2,3,3a,6,7,7a-hexahydroindole-1-carboxylate (PubChem CID 11702358) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is ethyl 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2,3,3a,6,7,7a-hexahydroindole-1-carboxylate.
| Compound Name | ethyl 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2,3,3a,6,7,7a-hexahydroindole-1-carboxylate |
|---|---|
| PubChem CID | 11702358 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | ethyl 4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2,3,3a,6,7,7a-hexahydroindole-1-carboxylate |
| SMILES | CCOC(=O)N1CCC2C(c3ncnc4[nH]ccc34)=CCCC21 |
| InChI | InChI=1S/C17H20N4O2/c1-2-23-17(22)21-9-7-11-12(4-3-5-14(11)21)15-13-6-8-18-16(13)20-10-19-15/h4,6,8,10-11,14H,2-3,5,7,9H2,1H3,(H,18,19,20) |
| InChIKey | CZEVECRJAQQXOZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |