C16H20N6O2 — CID 142744321
ethyl 5-[4-methyl-5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)triazol-2-yl]pentanoate (PubChem CID 142744321) has the molecular formula C16H20N6O2 and a molecular weight of 328.38 g/mol. Its IUPAC name is ethyl 5-[4-methyl-5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)triazol-2-yl]pentanoate.
| Compound Name | ethyl 5-[4-methyl-5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)triazol-2-yl]pentanoate |
|---|---|
| PubChem CID | 142744321 |
| Molecular Formula | C16H20N6O2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | ethyl 5-[4-methyl-5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)triazol-2-yl]pentanoate |
| SMILES | CCOC(=O)CCCCn1nc(C)c(-c2ncnc3[nH]ccc23)n1 |
| InChI | InChI=1S/C16H20N6O2/c1-3-24-13(23)6-4-5-9-22-20-11(2)14(21-22)15-12-7-8-17-16(12)19-10-18-15/h7-8,10H,3-6,9H2,1-2H3,(H,17,18,19) |
| InChIKey | NFNXASNVZXHPQP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|