C17H18N2O2S — CID 11702406
5-[4-[butyl(methyl)amino]-3-cyanophenyl]thiophene-2-carboxylic acid (PubChem CID 11702406) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 5-[4-[butyl(methyl)amino]-3-cyanophenyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[4-[butyl(methyl)amino]-3-cyanophenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 11702406 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 5-[4-[butyl(methyl)amino]-3-cyanophenyl]thiophene-2-carboxylic acid |
| SMILES | CCCCN(C)c1ccc(-c2ccc(C(=O)O)s2)cc1C#N |
| InChI | InChI=1S/C17H18N2O2S/c1-3-4-9-19(2)14-6-5-12(10-13(14)11-18)15-7-8-16(22-15)17(20)21/h5-8,10H,3-4,9H2,1-2H3,(H,20,21) |
| InChIKey | PPHIBMHSMQFSRB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |