C22H26N2O2S — CID 90269034
2-cyano-3-[5-[4-(dibutylamino)phenyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 90269034) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is 2-cyano-3-[5-[4-(dibutylamino)phenyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[5-[4-(dibutylamino)phenyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 90269034 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 2-cyano-3-[5-[4-(dibutylamino)phenyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CCCCN(CCCC)c1ccc(-c2ccc(C=C(C#N)C(=O)O)s2)cc1 |
| InChI | InChI=1S/C22H26N2O2S/c1-3-5-13-24(14-6-4-2)19-9-7-17(8-10-19)21-12-11-20(27-21)15-18(16-23)22(25)26/h7-12,15H,3-6,13-14H2,1-2H3,(H,25,26) |
| InChIKey | BKGSUXFNISRUCD-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|