2-[3,3-dimethyl-1-(2-methylphenyl)piperidin-4-yl]acetic acid

C16H23NO2 — CID 117024644

IUPAC2-[3,3-dimethyl-1-(2-methylphenyl)piperidin-4-yl]acetic acid
SMILESCc1ccccc1N1CCC(CC(=O)O)C(C)(C)C1
InChIInChI=1S/C16H23NO2/c1-12-6-4-5-7-14(12)17-9-8-13(10-15(18)19)16(2,3)11-17/h4-7,13H,8-11H2,1-3H3,(H,18,19)
InChIKeyCCGFNAXCVPFTBJ-UHFFFAOYSA-N
MW261.36 g/mol
LogP3.32
Rot. Bonds3

About 2-[3,3-dimethyl-1-(2-methylphenyl)piperidin-4-yl]acetic acid

2-[3,3-dimethyl-1-(2-methylphenyl)piperidin-4-yl]acetic acid (PubChem CID 117024644) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 2-[3,3-dimethyl-1-(2-methylphenyl)piperidin-4-yl]acetic acid.

Molecular Properties

Compound Name2-[3,3-dimethyl-1-(2-methylphenyl)piperidin-4-yl]acetic acid
PubChem CID117024644
Molecular FormulaC16H23NO2
Molecular Weight261.36 g/mol
Exact Mass261.17
IUPAC Name2-[3,3-dimethyl-1-(2-methylphenyl)piperidin-4-yl]acetic acid
SMILESCc1ccccc1N1CCC(CC(=O)O)C(C)(C)C1
InChIInChI=1S/C16H23NO2/c1-12-6-4-5-7-14(12)17-9-8-13(10-15(18)19)16(2,3)11-17/h4-7,13H,8-11H2,1-3H3,(H,18,19)
InChIKeyCCGFNAXCVPFTBJ-UHFFFAOYSA-N
XLogP3.32
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.36
LogP ≤ 53.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[3,3-dimethyl-1-(2-methylphenyl)piperidin-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3,3-dimethyl-1-(2-methylphenyl)piperidin-4-yl]acetic acid?
The IUPAC name of 2-[3,3-dimethyl-1-(2-methylphenyl)piperidin-4-yl]acetic acid (CID 117024644) is 2-[3,3-dimethyl-1-(2-methylphenyl)piperidin-4-yl]acetic acid.
What is the SMILES notation for 2-[3,3-dimethyl-1-(2-methylphenyl)piperidin-4-yl]acetic acid?
The canonical SMILES for 2-[3,3-dimethyl-1-(2-methylphenyl)piperidin-4-yl]acetic acid is Cc1ccccc1N1CCC(CC(=O)O)C(C)(C)C1.
What is the InChIKey of 2-[3,3-dimethyl-1-(2-methylphenyl)piperidin-4-yl]acetic acid?
The InChIKey is CCGFNAXCVPFTBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-12-6-4-5-7-14(12)17-9-8-13(10-15(18)19)16(2,3)11-17/h4-7,13H,8-11H2,1-3H3,(H,18,19).
What are the key properties of 2-[3,3-dimethyl-1-(2-methylphenyl)piperidin-4-yl]acetic acid?
2-[3,3-dimethyl-1-(2-methylphenyl)piperidin-4-yl]acetic acid has a molecular weight of 261.36 g/mol, XLogP of 3.32, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,3-dimethyl-1-(2-methylphenyl)piperidin-4-yl]acetic acid is sourced from PubChem (CID 117024644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).