C13H18FNO — CID 117025105
1-(2-fluorophenyl)-4,4-dimethylpiperidin-3-ol (PubChem CID 117025105) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4,4-dimethylpiperidin-3-ol.
| Compound Name | 1-(2-fluorophenyl)-4,4-dimethylpiperidin-3-ol |
|---|---|
| PubChem CID | 117025105 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 1-(2-fluorophenyl)-4,4-dimethylpiperidin-3-ol |
| SMILES | CC1(C)CCN(c2ccccc2F)CC1O |
| InChI | InChI=1S/C13H18FNO/c1-13(2)7-8-15(9-12(13)16)11-6-4-3-5-10(11)14/h3-6,12,16H,7-9H2,1-2H3 |
| InChIKey | LHNRPUFPNWSQJD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |