C12H21NO2 — CID 117025156
4,4-dimethyl-1-(oxolan-2-ylmethyl)piperidin-3-one (PubChem CID 117025156) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 4,4-dimethyl-1-(oxolan-2-ylmethyl)piperidin-3-one.
| Compound Name | 4,4-dimethyl-1-(oxolan-2-ylmethyl)piperidin-3-one |
|---|---|
| PubChem CID | 117025156 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 4,4-dimethyl-1-(oxolan-2-ylmethyl)piperidin-3-one |
| SMILES | CC1(C)CCN(CC2CCCO2)CC1=O |
| InChI | InChI=1S/C12H21NO2/c1-12(2)5-6-13(9-11(12)14)8-10-4-3-7-15-10/h10H,3-9H2,1-2H3 |
| InChIKey | VCARJPFHPOPMAU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |