About ethane;1-methyl-4-(oxolan-2-ylmethyl)piperazine;4-methylpiperazin-2-one
ethane;1-methyl-4-(oxolan-2-ylmethyl)piperazine;4-methylpiperazin-2-one (PubChem CID 171516221) has the molecular formula C23H54N4O2
and a molecular weight of 418.71 g/mol. Its IUPAC name is ethane;1-methyl-4-(oxolan-2-ylmethyl)piperazine;4-methylpiperazin-2-one.
Molecular Properties
| Compound Name | ethane;1-methyl-4-(oxolan-2-ylmethyl)piperazine;4-methylpiperazin-2-one |
| PubChem CID | 171516221 |
| Molecular Formula | C23H54N4O2 |
| Molecular Weight | 418.71 g/mol |
| Exact Mass | 418.42 |
| IUPAC Name | ethane;1-methyl-4-(oxolan-2-ylmethyl)piperazine;4-methylpiperazin-2-one |
| SMILES | CC.CC.CC.CC.CN1CCN(CC2CCCO2)CC1.CN1CCNC(=O)C1 |
| InChI | InChI=1S/C10H20N2O.C5H10N2O.4C2H6/c1-11-4-6-12(7-5-11)9-10-3-2-8-13-10;1-7-3-2-6-5(8)4-7;4*1-2/h10H,2-9H2,1H3;2-4H2,1H3,(H,6,8);4*1-2H3 |
| InChIKey | ADRICMTYRGFONS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.71 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;1-methyl-4-(oxolan-2-ylmethyl)piperazine;4-methylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-4-(oxolan-2-ylmethyl)piperazine;4-methylpiperazin-2-one?
The IUPAC name of ethane;1-methyl-4-(oxolan-2-ylmethyl)piperazine;4-methylpiperazin-2-one (CID 171516221) is ethane;1-methyl-4-(oxolan-2-ylmethyl)piperazine;4-methylpiperazin-2-one.
What is the SMILES notation for ethane;1-methyl-4-(oxolan-2-ylmethyl)piperazine;4-methylpiperazin-2-one?
The canonical SMILES for ethane;1-methyl-4-(oxolan-2-ylmethyl)piperazine;4-methylpiperazin-2-one is CC.CC.CC.CC.CN1CCN(CC2CCCO2)CC1.CN1CCNC(=O)C1.
What is the InChIKey of ethane;1-methyl-4-(oxolan-2-ylmethyl)piperazine;4-methylpiperazin-2-one?
The InChIKey is ADRICMTYRGFONS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O.C5H10N2O.4C2H6/c1-11-4-6-12(7-5-11)9-10-3-2-8-13-10;1-7-3-2-6-5(8)4-7;4*1-2/h10H,2-9H2,1H3;2-4H2,1H3,(H,6,8);4*1-2H3.
What are the key properties of ethane;1-methyl-4-(oxolan-2-ylmethyl)piperazine;4-methylpiperazin-2-one?
ethane;1-methyl-4-(oxolan-2-ylmethyl)piperazine;4-methylpiperazin-2-one has a molecular weight of 418.71 g/mol, XLogP of 3.57, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-4-(oxolan-2-ylmethyl)piperazine;4-methylpiperazin-2-one is sourced from PubChem (CID 171516221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).