C16H24BrN3 — CID 117026189
1-(2-bromo-4-methylphenyl)-4-piperidin-3-ylpiperazine (PubChem CID 117026189) has the molecular formula C16H24BrN3 and a molecular weight of 338.29 g/mol. Its IUPAC name is 1-(2-bromo-4-methylphenyl)-4-piperidin-3-ylpiperazine.
| Compound Name | 1-(2-bromo-4-methylphenyl)-4-piperidin-3-ylpiperazine |
|---|---|
| PubChem CID | 117026189 |
| Molecular Formula | C16H24BrN3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1-(2-bromo-4-methylphenyl)-4-piperidin-3-ylpiperazine |
| SMILES | Cc1ccc(N2CCN(C3CCCNC3)CC2)c(Br)c1 |
| InChI | InChI=1S/C16H24BrN3/c1-13-4-5-16(15(17)11-13)20-9-7-19(8-10-20)14-3-2-6-18-12-14/h4-5,11,14,18H,2-3,6-10,12H2,1H3 |
| InChIKey | AGWMQHRIUADGOA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |