C20H26O4 — CID 11702679
(E,17S)-17-(methoxymethoxy)octadec-15-en-9,11,13-triynoic acid (PubChem CID 11702679) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (E,17S)-17-(methoxymethoxy)octadec-15-en-9,11,13-triynoic acid.
| Compound Name | (E,17S)-17-(methoxymethoxy)octadec-15-en-9,11,13-triynoic acid |
|---|---|
| PubChem CID | 11702679 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (E,17S)-17-(methoxymethoxy)octadec-15-en-9,11,13-triynoic acid |
| SMILES | COCO[C@@H](C)/C=C/C#CC#CC#CCCCCCCCC(=O)O |
| InChI | InChI=1S/C20H26O4/c1-19(24-18-23-2)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-20(21)22/h14,16,19H,5,7,9,11,13,15,17-18H2,1-2H3,(H,21,22)/b16-14+/t19-/m0/s1 |
| InChIKey | OQLFYHQPTICVKX-IDCODDLRSA-N |
| XLogP | 3.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|