C13H21N3O2 — CID 117026870
[4-(2,4-dimethoxyphenyl)piperazin-2-yl]methanamine (PubChem CID 117026870) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is [4-(2,4-dimethoxyphenyl)piperazin-2-yl]methanamine.
| Compound Name | [4-(2,4-dimethoxyphenyl)piperazin-2-yl]methanamine |
|---|---|
| PubChem CID | 117026870 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | [4-(2,4-dimethoxyphenyl)piperazin-2-yl]methanamine |
| SMILES | COc1ccc(N2CCNC(CN)C2)c(OC)c1 |
| InChI | InChI=1S/C13H21N3O2/c1-17-11-3-4-12(13(7-11)18-2)16-6-5-15-10(8-14)9-16/h3-4,7,10,15H,5-6,8-9,14H2,1-2H3 |
| InChIKey | MEGRSPFLBXZKLB-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|