About [1-(2,4-dimethoxyphenyl)-5,5-dimethylpyrrolidin-3-yl]methanamine
[1-(2,4-dimethoxyphenyl)-5,5-dimethylpyrrolidin-3-yl]methanamine (PubChem CID 117018796) has the molecular formula C15H24N2O2
and a molecular weight of 264.37 g/mol. Its IUPAC name is [1-(2,4-dimethoxyphenyl)-5,5-dimethylpyrrolidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [1-(2,4-dimethoxyphenyl)-5,5-dimethylpyrrolidin-3-yl]methanamine |
| PubChem CID | 117018796 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | [1-(2,4-dimethoxyphenyl)-5,5-dimethylpyrrolidin-3-yl]methanamine |
| SMILES | COc1ccc(N2CC(CN)CC2(C)C)c(OC)c1 |
| InChI | InChI=1S/C15H24N2O2/c1-15(2)8-11(9-16)10-17(15)13-6-5-12(18-3)7-14(13)19-4/h5-7,11H,8-10,16H2,1-4H3 |
| InChIKey | LTJVHOXPSKYRMW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,4-dimethoxyphenyl)-5,5-dimethylpyrrolidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,4-dimethoxyphenyl)-5,5-dimethylpyrrolidin-3-yl]methanamine?
The IUPAC name of [1-(2,4-dimethoxyphenyl)-5,5-dimethylpyrrolidin-3-yl]methanamine (CID 117018796) is [1-(2,4-dimethoxyphenyl)-5,5-dimethylpyrrolidin-3-yl]methanamine.
What is the SMILES notation for [1-(2,4-dimethoxyphenyl)-5,5-dimethylpyrrolidin-3-yl]methanamine?
The canonical SMILES for [1-(2,4-dimethoxyphenyl)-5,5-dimethylpyrrolidin-3-yl]methanamine is COc1ccc(N2CC(CN)CC2(C)C)c(OC)c1.
What is the InChIKey of [1-(2,4-dimethoxyphenyl)-5,5-dimethylpyrrolidin-3-yl]methanamine?
The InChIKey is LTJVHOXPSKYRMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2/c1-15(2)8-11(9-16)10-17(15)13-6-5-12(18-3)7-14(13)19-4/h5-7,11H,8-10,16H2,1-4H3.
What are the key properties of [1-(2,4-dimethoxyphenyl)-5,5-dimethylpyrrolidin-3-yl]methanamine?
[1-(2,4-dimethoxyphenyl)-5,5-dimethylpyrrolidin-3-yl]methanamine has a molecular weight of 264.37 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,4-dimethoxyphenyl)-5,5-dimethylpyrrolidin-3-yl]methanamine is sourced from PubChem (CID 117018796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).