C10H15ClN2 — CID 117027031
3-N-(3-chlorophenyl)butane-1,3-diamine (PubChem CID 117027031) has the molecular formula C10H15ClN2 and a molecular weight of 198.70 g/mol. Its IUPAC name is 3-N-(3-chlorophenyl)butane-1,3-diamine.
| Compound Name | 3-N-(3-chlorophenyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 117027031 |
| Molecular Formula | C10H15ClN2 |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 3-N-(3-chlorophenyl)butane-1,3-diamine |
| SMILES | CC(CCN)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C10H15ClN2/c1-8(5-6-12)13-10-4-2-3-9(11)7-10/h2-4,7-8,13H,5-6,12H2,1H3 |
| InChIKey | PXRKPYVUNSFMKC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |