About 4-N-(4-bromophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine
4-N-(4-bromophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 117029083) has the molecular formula C14H15BrN2
and a molecular weight of 291.19 g/mol. Its IUPAC name is 4-N-(4-bromophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine.
Molecular Properties
| Compound Name | 4-N-(4-bromophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine |
| PubChem CID | 117029083 |
| Molecular Formula | C14H15BrN2 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-N-(4-bromophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | CNc1ccc(N(C)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C14H15BrN2/c1-16-12-5-9-14(10-6-12)17(2)13-7-3-11(15)4-8-13/h3-10,16H,1-2H3 |
| InChIKey | BLWPOOIAPPEOKQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-N-(4-bromophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(4-bromophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine?
The IUPAC name of 4-N-(4-bromophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine (CID 117029083) is 4-N-(4-bromophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine.
What is the SMILES notation for 4-N-(4-bromophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine?
The canonical SMILES for 4-N-(4-bromophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine is CNc1ccc(N(C)c2ccc(Br)cc2)cc1.
What is the InChIKey of 4-N-(4-bromophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine?
The InChIKey is BLWPOOIAPPEOKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrN2/c1-16-12-5-9-14(10-6-12)17(2)13-7-3-11(15)4-8-13/h3-10,16H,1-2H3.
What are the key properties of 4-N-(4-bromophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine?
4-N-(4-bromophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine has a molecular weight of 291.19 g/mol, XLogP of 4.26, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(4-bromophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine is sourced from PubChem (CID 117029083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).