C14H15BrN2 — CID 117029083
4-N-(4-bromophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 117029083) has the molecular formula C14H15BrN2 and a molecular weight of 291.19 g/mol. Its IUPAC name is 4-N-(4-bromophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 4-N-(4-bromophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 117029083 |
| Molecular Formula | C14H15BrN2 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-N-(4-bromophenyl)-1-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | CNc1ccc(N(C)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C14H15BrN2/c1-16-12-5-9-14(10-6-12)17(2)13-7-3-11(15)4-8-13/h3-10,16H,1-2H3 |
| InChIKey | BLWPOOIAPPEOKQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |