C13H21NS — CID 117032698
4-(2,4,6-trimethylphenyl)sulfanylbutan-2-amine (PubChem CID 117032698) has the molecular formula C13H21NS and a molecular weight of 223.38 g/mol. Its IUPAC name is 4-(2,4,6-trimethylphenyl)sulfanylbutan-2-amine.
| Compound Name | 4-(2,4,6-trimethylphenyl)sulfanylbutan-2-amine |
|---|---|
| PubChem CID | 117032698 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 4-(2,4,6-trimethylphenyl)sulfanylbutan-2-amine |
| SMILES | Cc1cc(C)c(SCCC(C)N)c(C)c1 |
| InChI | InChI=1S/C13H21NS/c1-9-7-10(2)13(11(3)8-9)15-6-5-12(4)14/h7-8,12H,5-6,14H2,1-4H3 |
| InChIKey | NCPSTSOFRQPFRH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |