C13H15BrO2S — CID 117033587
4-(4-bromophenyl)sulfanylcyclohexane-1-carboxylic acid (PubChem CID 117033587) has the molecular formula C13H15BrO2S and a molecular weight of 315.23 g/mol. Its IUPAC name is 4-(4-bromophenyl)sulfanylcyclohexane-1-carboxylic acid.
| Compound Name | 4-(4-bromophenyl)sulfanylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117033587 |
| Molecular Formula | C13H15BrO2S |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 4-(4-bromophenyl)sulfanylcyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(Sc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C13H15BrO2S/c14-10-3-7-12(8-4-10)17-11-5-1-9(2-6-11)13(15)16/h3-4,7-9,11H,1-2,5-6H2,(H,15,16) |
| InChIKey | HPKRRCKMKQFJIB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |