About S-(2-methoxy-5-methylphenyl) methanethioate
S-(2-methoxy-5-methylphenyl) methanethioate (PubChem CID 117033659) has the molecular formula C9H10O2S
and a molecular weight of 182.24 g/mol. Its IUPAC name is S-(2-methoxy-5-methylphenyl) methanethioate.
Molecular Properties
| Compound Name | S-(2-methoxy-5-methylphenyl) methanethioate |
| PubChem CID | 117033659 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | S-(2-methoxy-5-methylphenyl) methanethioate |
| SMILES | COc1ccc(C)cc1SC=O |
| InChI | InChI=1S/C9H10O2S/c1-7-3-4-8(11-2)9(5-7)12-6-10/h3-6H,1-2H3 |
| InChIKey | QPVRTOMXECWERL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-methoxy-5-methylphenyl) methanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-methoxy-5-methylphenyl) methanethioate?
The IUPAC name of S-(2-methoxy-5-methylphenyl) methanethioate (CID 117033659) is S-(2-methoxy-5-methylphenyl) methanethioate.
What is the SMILES notation for S-(2-methoxy-5-methylphenyl) methanethioate?
The canonical SMILES for S-(2-methoxy-5-methylphenyl) methanethioate is COc1ccc(C)cc1SC=O.
What is the InChIKey of S-(2-methoxy-5-methylphenyl) methanethioate?
The InChIKey is QPVRTOMXECWERL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2S/c1-7-3-4-8(11-2)9(5-7)12-6-10/h3-6H,1-2H3.
What are the key properties of S-(2-methoxy-5-methylphenyl) methanethioate?
S-(2-methoxy-5-methylphenyl) methanethioate has a molecular weight of 182.24 g/mol, XLogP of 2.29, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-methoxy-5-methylphenyl) methanethioate is sourced from PubChem (CID 117033659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).