C14H16N2OS — CID 117033981
3-[(1-acetyl-3,4-dihydro-2H-quinolin-6-yl)sulfanyl]propanenitrile (PubChem CID 117033981) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is 3-[(1-acetyl-3,4-dihydro-2H-quinolin-6-yl)sulfanyl]propanenitrile.
| Compound Name | 3-[(1-acetyl-3,4-dihydro-2H-quinolin-6-yl)sulfanyl]propanenitrile |
|---|---|
| PubChem CID | 117033981 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 3-[(1-acetyl-3,4-dihydro-2H-quinolin-6-yl)sulfanyl]propanenitrile |
| SMILES | CC(=O)N1CCCc2cc(SCCC#N)ccc21 |
| InChI | InChI=1S/C14H16N2OS/c1-11(17)16-8-2-4-12-10-13(5-6-14(12)16)18-9-3-7-15/h5-6,10H,2-4,8-9H2,1H3 |
| InChIKey | LPFNMBCMLBEBLT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|