C13H19FN2S — CID 117034403
3-[(4-fluoro-2-methylphenyl)sulfanylmethyl]-1-methylpiperazine (PubChem CID 117034403) has the molecular formula C13H19FN2S and a molecular weight of 254.37 g/mol. Its IUPAC name is 3-[(4-fluoro-2-methylphenyl)sulfanylmethyl]-1-methylpiperazine.
| Compound Name | 3-[(4-fluoro-2-methylphenyl)sulfanylmethyl]-1-methylpiperazine |
|---|---|
| PubChem CID | 117034403 |
| Molecular Formula | C13H19FN2S |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3-[(4-fluoro-2-methylphenyl)sulfanylmethyl]-1-methylpiperazine |
| SMILES | Cc1cc(F)ccc1SCC1CN(C)CCN1 |
| InChI | InChI=1S/C13H19FN2S/c1-10-7-11(14)3-4-13(10)17-9-12-8-16(2)6-5-15-12/h3-4,7,12,15H,5-6,8-9H2,1-2H3 |
| InChIKey | DOIKWENCPSNGEQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |