C12H16FNS — CID 117034948
[1-(4-fluoro-3-methylphenyl)sulfanylcyclobutyl]methanamine (PubChem CID 117034948) has the molecular formula C12H16FNS and a molecular weight of 225.33 g/mol. Its IUPAC name is [1-(4-fluoro-3-methylphenyl)sulfanylcyclobutyl]methanamine.
| Compound Name | [1-(4-fluoro-3-methylphenyl)sulfanylcyclobutyl]methanamine |
|---|---|
| PubChem CID | 117034948 |
| Molecular Formula | C12H16FNS |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | [1-(4-fluoro-3-methylphenyl)sulfanylcyclobutyl]methanamine |
| SMILES | Cc1cc(SC2(CN)CCC2)ccc1F |
| InChI | InChI=1S/C12H16FNS/c1-9-7-10(3-4-11(9)13)15-12(8-14)5-2-6-12/h3-4,7H,2,5-6,8,14H2,1H3 |
| InChIKey | WHRYBPKRLXNPJA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |