C13H19NO2S — CID 117034954
[1-(3,4-dimethoxyphenyl)sulfanylcyclobutyl]methanamine (PubChem CID 117034954) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is [1-(3,4-dimethoxyphenyl)sulfanylcyclobutyl]methanamine.
| Compound Name | [1-(3,4-dimethoxyphenyl)sulfanylcyclobutyl]methanamine |
|---|---|
| PubChem CID | 117034954 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | [1-(3,4-dimethoxyphenyl)sulfanylcyclobutyl]methanamine |
| SMILES | COc1ccc(SC2(CN)CCC2)cc1OC |
| InChI | InChI=1S/C13H19NO2S/c1-15-11-5-4-10(8-12(11)16-2)17-13(9-14)6-3-7-13/h4-5,8H,3,6-7,9,14H2,1-2H3 |
| InChIKey | RGFWUWNCJJOYIJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |