C13H18BrN3S — CID 117039540
1-amino-4-[(4-bromothiophen-2-yl)methyl-methylamino]cyclohexane-1-carbonitrile (PubChem CID 117039540) has the molecular formula C13H18BrN3S and a molecular weight of 328.28 g/mol. Its IUPAC name is 1-amino-4-[(4-bromothiophen-2-yl)methyl-methylamino]cyclohexane-1-carbonitrile.
| Compound Name | 1-amino-4-[(4-bromothiophen-2-yl)methyl-methylamino]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 117039540 |
| Molecular Formula | C13H18BrN3S |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 1-amino-4-[(4-bromothiophen-2-yl)methyl-methylamino]cyclohexane-1-carbonitrile |
| SMILES | CN(Cc1cc(Br)cs1)C1CCC(N)(C#N)CC1 |
| InChI | InChI=1S/C13H18BrN3S/c1-17(7-12-6-10(14)8-18-12)11-2-4-13(16,9-15)5-3-11/h6,8,11H,2-5,7,16H2,1H3 |
| InChIKey | VPJRNGORCLHJRR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |