C12H16N2S — CID 117039948
2-N-(1-benzothiophen-3-yl)-2-N-methylpropane-1,2-diamine (PubChem CID 117039948) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 2-N-(1-benzothiophen-3-yl)-2-N-methylpropane-1,2-diamine.
| Compound Name | 2-N-(1-benzothiophen-3-yl)-2-N-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 117039948 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-N-(1-benzothiophen-3-yl)-2-N-methylpropane-1,2-diamine |
| SMILES | CC(CN)N(C)c1csc2ccccc12 |
| InChI | InChI=1S/C12H16N2S/c1-9(7-13)14(2)11-8-15-12-6-4-3-5-10(11)12/h3-6,8-9H,7,13H2,1-2H3 |
| InChIKey | WBZVBTYSLGESND-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |