About N-(3,4-difluorophenyl)-N-methylazetidin-3-amine
N-(3,4-difluorophenyl)-N-methylazetidin-3-amine (PubChem CID 117040558) has the molecular formula C10H12F2N2
and a molecular weight of 198.22 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-N-methylazetidin-3-amine.
Molecular Properties
| Compound Name | N-(3,4-difluorophenyl)-N-methylazetidin-3-amine |
| PubChem CID | 117040558 |
| Molecular Formula | C10H12F2N2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | N-(3,4-difluorophenyl)-N-methylazetidin-3-amine |
| SMILES | CN(c1ccc(F)c(F)c1)C1CNC1 |
| InChI | InChI=1S/C10H12F2N2/c1-14(8-5-13-6-8)7-2-3-9(11)10(12)4-7/h2-4,8,13H,5-6H2,1H3 |
| InChIKey | ZUBPEAVROWDDPH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3,4-difluorophenyl)-N-methylazetidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-difluorophenyl)-N-methylazetidin-3-amine?
The IUPAC name of N-(3,4-difluorophenyl)-N-methylazetidin-3-amine (CID 117040558) is N-(3,4-difluorophenyl)-N-methylazetidin-3-amine.
What is the SMILES notation for N-(3,4-difluorophenyl)-N-methylazetidin-3-amine?
The canonical SMILES for N-(3,4-difluorophenyl)-N-methylazetidin-3-amine is CN(c1ccc(F)c(F)c1)C1CNC1.
What is the InChIKey of N-(3,4-difluorophenyl)-N-methylazetidin-3-amine?
The InChIKey is ZUBPEAVROWDDPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2N2/c1-14(8-5-13-6-8)7-2-3-9(11)10(12)4-7/h2-4,8,13H,5-6H2,1H3.
What are the key properties of N-(3,4-difluorophenyl)-N-methylazetidin-3-amine?
N-(3,4-difluorophenyl)-N-methylazetidin-3-amine has a molecular weight of 198.22 g/mol, XLogP of 1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-difluorophenyl)-N-methylazetidin-3-amine is sourced from PubChem (CID 117040558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).