C13H20N2S — CID 117040828
N-methyl-N-[2-(4-methylsulfanylphenyl)ethyl]azetidin-3-amine (PubChem CID 117040828) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is N-methyl-N-[2-(4-methylsulfanylphenyl)ethyl]azetidin-3-amine.
| Compound Name | N-methyl-N-[2-(4-methylsulfanylphenyl)ethyl]azetidin-3-amine |
|---|---|
| PubChem CID | 117040828 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N-methyl-N-[2-(4-methylsulfanylphenyl)ethyl]azetidin-3-amine |
| SMILES | CSc1ccc(CCN(C)C2CNC2)cc1 |
| InChI | InChI=1S/C13H20N2S/c1-15(12-9-14-10-12)8-7-11-3-5-13(16-2)6-4-11/h3-6,12,14H,7-10H2,1-2H3 |
| InChIKey | STVWAKNGPKKMAH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |