C14H21ClN2S — CID 120660835
(3aR,6aS)-5-[(4-methylsulfanylphenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 120660835) has the molecular formula C14H21ClN2S and a molecular weight of 284.86 g/mol. Its IUPAC name is (3aR,6aS)-5-[(4-methylsulfanylphenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3aR,6aS)-5-[(4-methylsulfanylphenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 120660835 |
| Molecular Formula | C14H21ClN2S |
| Molecular Weight | 284.86 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (3aR,6aS)-5-[(4-methylsulfanylphenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | CSc1ccc(CN2C[C@H]3CNC[C@H]3C2)cc1.Cl |
| InChI | InChI=1S/C14H20N2S.ClH/c1-17-14-4-2-11(3-5-14)8-16-9-12-6-15-7-13(12)10-16;/h2-5,12-13,15H,6-10H2,1H3;1H/t12-,13+; |
| InChIKey | WNAKYOOAYPVJNT-OEEJBDNKSA-N |
| XLogP | 2.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.86 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |