C11H19ClN4 — CID 120660803
(3aR,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 120660803) has the molecular formula C11H19ClN4 and a molecular weight of 242.75 g/mol. Its IUPAC name is (3aR,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3aR,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 120660803 |
| Molecular Formula | C11H19ClN4 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (3aR,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | Cl.Cn1cc(CN2C[C@H]3CNC[C@H]3C2)cn1 |
| InChI | InChI=1S/C11H18N4.ClH/c1-14-5-9(2-13-14)6-15-7-10-3-12-4-11(10)8-15;/h2,5,10-12H,3-4,6-8H2,1H3;1H/t10-,11+; |
| InChIKey | CKPJJIKHGYSXRV-NJJJQDLFSA-N |
| XLogP | 0.49 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |